About N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine
N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine (PubChem CID 66657947) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine.
Analyze N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine?
The IUPAC name of N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine (CID 66657947) is N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine is CC(NCCN)c1ccnn1C.
What is the InChIKey of N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine?
The InChIKey is FRCCIPSYFZSTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-7(10-6-4-9)8-3-5-11-12(8)2/h3,5,7,10H,4,6,9H2,1-2H3.
What are the key properties of N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine?
N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine has a molecular weight of 168.24 g/mol, XLogP of 0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(2-methylpyrazol-3-yl)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 66657947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).