C12H17ClN2 — CID 106759556
1-N-[(E)-4-chlorobut-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 106759556) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-N-[(E)-4-chlorobut-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 1-N-[(E)-4-chlorobut-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 106759556 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-N-[(E)-4-chlorobut-2-enyl]-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CN(C)c1ccccc1NC/C=C/CCl |
| InChI | InChI=1S/C12H17ClN2/c1-15(2)12-8-4-3-7-11(12)14-10-6-5-9-13/h3-8,14H,9-10H2,1-2H3/b6-5+ |
| InChIKey | GFGBICYPVGECNF-AATRIKPKSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|