C16H17ClN4 — CID 106760331
2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline (PubChem CID 106760331) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline.
| Compound Name | 2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 106760331 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1-n1c(CCCl)nc2cnccc21 |
| InChI | InChI=1S/C16H17ClN4/c1-20(2)14-5-3-4-6-15(14)21-13-8-10-18-11-12(13)19-16(21)7-9-17/h3-6,8,10-11H,7,9H2,1-2H3 |
| InChIKey | YJQYGKZVVCNTMI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|