C28H49N3+2 — CID 10676046
[(5S,8R,9S,10R,13S,14S,17S)-5-cyano-10,13-dimethyl-3-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-trimethylazanium (PubChem CID 10676046) has the molecular formula C28H49N3+2 and a molecular weight of 427.72 g/mol. Its IUPAC name is [(5S,8R,9S,10R,13S,14S,17S)-5-cyano-10,13-dimethyl-3-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-trimethylazanium.
| Compound Name | [(5S,8R,9S,10R,13S,14S,17S)-5-cyano-10,13-dimethyl-3-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-trimethylazanium |
|---|---|
| PubChem CID | 10676046 |
| Molecular Formula | C28H49N3+2 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.39 |
| IUPAC Name | [(5S,8R,9S,10R,13S,14S,17S)-5-cyano-10,13-dimethyl-3-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-trimethylazanium |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@]4(C#N)CC([N+]5(C)CCCC5)CC[C@]34C)[C@@H]1CC[C@@H]2[N+](C)(C)C |
| InChI | InChI=1S/C28H49N3/c1-26-14-13-24-22(23(26)9-10-25(26)30(3,4)5)12-16-28(20-29)19-21(11-15-27(24,28)2)31(6)17-7-8-18-31/h21-25H,7-19H2,1-6H3/q+2/t21?,22-,23-,24-,25-,26-,27+,28+/m0/s1 |
| InChIKey | ISFJEYLXEYRSBI-OBTAGWDKSA-N |
| XLogP | 5.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|