C10H6BrClF4O — CID 106761854
1-(4-bromo-3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-one (PubChem CID 106761854) has the molecular formula C10H6BrClF4O and a molecular weight of 333.51 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 106761854 |
| Molecular Formula | C10H6BrClF4O |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C10H6BrClF4O/c11-6-2-1-5(9(13)8(6)12)7(17)3-4-10(14,15)16/h1-2H,3-4H2 |
| InChIKey | LJUCUDJZLCPPDS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|