C10H7BrF4O — CID 89480353
1-(3-bromo-2-fluorophenyl)-4,4,4-trifluorobutan-1-one (PubChem CID 89480353) has the molecular formula C10H7BrF4O and a molecular weight of 299.06 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 89480353 |
| Molecular Formula | C10H7BrF4O |
| Molecular Weight | 299.06 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H7BrF4O/c11-7-3-1-2-6(9(7)12)8(16)4-5-10(13,14)15/h1-3H,4-5H2 |
| InChIKey | BDEOGZBIPCRBKU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.06 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |