C14H12BrClFNO — CID 106762147
(4-bromo-3-chloro-2-fluorophenyl)-(3,5-dimethyl-2-pyridinyl)methanol (PubChem CID 106762147) has the molecular formula C14H12BrClFNO and a molecular weight of 344.61 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(3,5-dimethyl-2-pyridinyl)methanol.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(3,5-dimethyl-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 106762147 |
| Molecular Formula | C14H12BrClFNO |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(3,5-dimethyl-2-pyridinyl)methanol |
| SMILES | Cc1cnc(C(O)c2ccc(Br)c(Cl)c2F)c(C)c1 |
| InChI | InChI=1S/C14H12BrClFNO/c1-7-5-8(2)13(18-6-7)14(19)9-3-4-10(15)11(16)12(9)17/h3-6,14,19H,1-2H3 |
| InChIKey | ITTDGIZQBDSBRJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|