C16H22BrClFN — CID 106763841
N-[[2-(4-bromo-3-chloro-2-fluorophenyl)cyclohexyl]methyl]propan-2-amine (PubChem CID 106763841) has the molecular formula C16H22BrClFN and a molecular weight of 362.71 g/mol. Its IUPAC name is N-[[2-(4-bromo-3-chloro-2-fluorophenyl)cyclohexyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(4-bromo-3-chloro-2-fluorophenyl)cyclohexyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106763841 |
| Molecular Formula | C16H22BrClFN |
| Molecular Weight | 362.71 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-[[2-(4-bromo-3-chloro-2-fluorophenyl)cyclohexyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCCCC1c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C16H22BrClFN/c1-10(2)20-9-11-5-3-4-6-12(11)13-7-8-14(17)15(18)16(13)19/h7-8,10-12,20H,3-6,9H2,1-2H3 |
| InChIKey | NBTTWYUPHVKLIL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|