C17H24BrF2N — CID 106943915
N-[[2-(3-bromo-2,6-difluorophenyl)cycloheptyl]methyl]propan-2-amine (PubChem CID 106943915) has the molecular formula C17H24BrF2N and a molecular weight of 360.29 g/mol. Its IUPAC name is N-[[2-(3-bromo-2,6-difluorophenyl)cycloheptyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(3-bromo-2,6-difluorophenyl)cycloheptyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106943915 |
| Molecular Formula | C17H24BrF2N |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[[2-(3-bromo-2,6-difluorophenyl)cycloheptyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCCCCC1c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C17H24BrF2N/c1-11(2)21-10-12-6-4-3-5-7-13(12)16-15(19)9-8-14(18)17(16)20/h8-9,11-13,21H,3-7,10H2,1-2H3 |
| InChIKey | NRFDDLJTDBJKFC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|