2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid

C14H15BrF2O2 — CID 106943848

IUPAC2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid
SMILESO=C(O)C1CCCCCC1c1c(F)ccc(Br)c1F
InChIInChI=1S/C14H15BrF2O2/c15-10-6-7-11(16)12(13(10)17)8-4-2-1-3-5-9(8)14(18)19/h6-9H,1-5H2,(H,18,19)
InChIKeyOUGOGIHRBANHJN-UHFFFAOYSA-N
MW333.17 g/mol
LogP4.48
Rot. Bonds2

About 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid

2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid (PubChem CID 106943848) has the molecular formula C14H15BrF2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid.

Molecular Properties

Compound Name2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid
PubChem CID106943848
Molecular FormulaC14H15BrF2O2
Molecular Weight333.17 g/mol
Exact Mass332.02
IUPAC Name2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid
SMILESO=C(O)C1CCCCCC1c1c(F)ccc(Br)c1F
InChIInChI=1S/C14H15BrF2O2/c15-10-6-7-11(16)12(13(10)17)8-4-2-1-3-5-9(8)14(18)19/h6-9H,1-5H2,(H,18,19)
InChIKeyOUGOGIHRBANHJN-UHFFFAOYSA-N
XLogP4.48
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.17
LogP ≤ 54.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid?
The IUPAC name of 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid (CID 106943848) is 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid.
What is the SMILES notation for 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid?
The canonical SMILES for 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid is O=C(O)C1CCCCCC1c1c(F)ccc(Br)c1F.
What is the InChIKey of 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid?
The InChIKey is OUGOGIHRBANHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrF2O2/c15-10-6-7-11(16)12(13(10)17)8-4-2-1-3-5-9(8)14(18)19/h6-9H,1-5H2,(H,18,19).
What are the key properties of 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid?
2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid has a molecular weight of 333.17 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid is sourced from PubChem (CID 106943848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).