C14H15BrF2O2 — CID 106943848
2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid (PubChem CID 106943848) has the molecular formula C14H15BrF2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 106943848 |
| Molecular Formula | C14H15BrF2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCCC1c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H15BrF2O2/c15-10-6-7-11(16)12(13(10)17)8-4-2-1-3-5-9(8)14(18)19/h6-9H,1-5H2,(H,18,19) |
| InChIKey | OUGOGIHRBANHJN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|