C16H12BrClFNO — CID 106764101
(4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydroquinolin-5-yl)methanone (PubChem CID 106764101) has the molecular formula C16H12BrClFNO and a molecular weight of 368.63 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydroquinolin-5-yl)methanone.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydroquinolin-5-yl)methanone |
|---|---|
| PubChem CID | 106764101 |
| Molecular Formula | C16H12BrClFNO |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydroquinolin-5-yl)methanone |
| SMILES | O=C(c1ccc(Br)c(Cl)c1F)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C16H12BrClFNO/c17-12-7-6-11(15(19)14(12)18)16(21)10-3-1-5-13-9(10)4-2-8-20-13/h1,3,5-7,20H,2,4,8H2 |
| InChIKey | QQLKOBQJSDJZKF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|