C15H9BrClFO3 — CID 106764282
(4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone (PubChem CID 106764282) has the molecular formula C15H9BrClFO3 and a molecular weight of 371.59 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone |
|---|---|
| PubChem CID | 106764282 |
| Molecular Formula | C15H9BrClFO3 |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone |
| SMILES | O=C(c1ccc(Br)c(Cl)c1F)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H9BrClFO3/c16-10-5-4-8(13(18)12(10)17)14(19)9-2-1-3-11-15(9)21-7-6-20-11/h1-5H,6-7H2 |
| InChIKey | OLAKKNICEAOUGT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|