C13H9ClN4O2 — CID 106766417
1-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)isoquinoline-4-carboxamide (PubChem CID 106766417) has the molecular formula C13H9ClN4O2 and a molecular weight of 288.69 g/mol. Its IUPAC name is 1-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)isoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106766417 |
| Molecular Formula | C13H9ClN4O2 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)isoquinoline-4-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2cnc(Cl)c3ccccc23)o1 |
| InChI | InChI=1S/C13H9ClN4O2/c1-7-17-18-13(20-7)16-12(19)10-6-15-11(14)9-5-3-2-4-8(9)10/h2-6H,1H3,(H,16,18,19) |
| InChIKey | GPLUBBPXFHPLAA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|