C10H11ClF3N3O — CID 106767801
6-chloro-N-(oxan-3-yl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106767801) has the molecular formula C10H11ClF3N3O and a molecular weight of 281.67 g/mol. Its IUPAC name is 6-chloro-N-(oxan-3-yl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(oxan-3-yl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106767801 |
| Molecular Formula | C10H11ClF3N3O |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 6-chloro-N-(oxan-3-yl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1nc(Cl)cc(NC2CCCOC2)n1 |
| InChI | InChI=1S/C10H11ClF3N3O/c11-7-4-8(15-6-2-1-3-18-5-6)17-9(16-7)10(12,13)14/h4,6H,1-3,5H2,(H,15,16,17) |
| InChIKey | NCBKERQMFSOZCD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |