C11H13ClF3N3 — CID 106767917
6-chloro-N-(1-methylcyclopentyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106767917) has the molecular formula C11H13ClF3N3 and a molecular weight of 279.69 g/mol. Its IUPAC name is 6-chloro-N-(1-methylcyclopentyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1-methylcyclopentyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106767917 |
| Molecular Formula | C11H13ClF3N3 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 6-chloro-N-(1-methylcyclopentyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CC1(Nc2cc(Cl)nc(C(F)(F)F)n2)CCCC1 |
| InChI | InChI=1S/C11H13ClF3N3/c1-10(4-2-3-5-10)18-8-6-7(12)16-9(17-8)11(13,14)15/h6H,2-5H2,1H3,(H,16,17,18) |
| InChIKey | HSZSJECPMJHFKY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |