C12H16ClN3 — CID 115875734
6-chloro-2-cyclopropyl-N-(1-methylcyclobutyl)pyrimidin-4-amine (PubChem CID 115875734) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-(1-methylcyclobutyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-(1-methylcyclobutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115875734 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-(1-methylcyclobutyl)pyrimidin-4-amine |
| SMILES | CC1(Nc2cc(Cl)nc(C3CC3)n2)CCC1 |
| InChI | InChI=1S/C12H16ClN3/c1-12(5-2-6-12)16-10-7-9(13)14-11(15-10)8-3-4-8/h7-8H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | DEUWKJGHMNTHMX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |