C13H13F3N4 — CID 106769805
N-ethyl-6-(pyridin-3-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106769805) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is N-ethyl-6-(pyridin-3-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-(pyridin-3-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106769805 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-ethyl-6-(pyridin-3-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(Cc2cccnc2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F3N4/c1-2-18-11-7-10(6-9-4-3-5-17-8-9)19-12(20-11)13(14,15)16/h3-5,7-8H,2,6H2,1H3,(H,18,19,20) |
| InChIKey | ZNOUZDVQSQOTGL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |