C12H10F3IN4 — CID 106770063
4-N-(3-iodophenyl)-6-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine (PubChem CID 106770063) has the molecular formula C12H10F3IN4 and a molecular weight of 394.14 g/mol. Its IUPAC name is 4-N-(3-iodophenyl)-6-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-iodophenyl)-6-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106770063 |
| Molecular Formula | C12H10F3IN4 |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 4-N-(3-iodophenyl)-6-N-methyl-2-(trifluoromethyl)pyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2cccc(I)c2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H10F3IN4/c1-17-9-6-10(20-11(19-9)12(13,14)15)18-8-4-2-3-7(16)5-8/h2-6H,1H3,(H2,17,18,19,20) |
| InChIKey | PVIVCQCXYIWBTN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|