About 3-iodo-N-methylaniline
3-iodo-N-methylaniline (PubChem CID 11075306) has the molecular formula C7H8IN
and a molecular weight of 233.05 g/mol. Its IUPAC name is 3-iodo-N-methylaniline.
Molecular Properties
| Compound Name | 3-iodo-N-methylaniline |
| PubChem CID | 11075306 |
| Molecular Formula | C7H8IN |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | 3-iodo-N-methylaniline |
| SMILES | CNc1cccc(I)c1 |
| InChI | InChI=1S/C7H8IN/c1-9-7-4-2-3-6(8)5-7/h2-5,9H,1H3 |
| InChIKey | KWXWYCMFWSWUQK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-N-methylaniline?
The IUPAC name of 3-iodo-N-methylaniline (CID 11075306) is 3-iodo-N-methylaniline.
What is the SMILES notation for 3-iodo-N-methylaniline?
The canonical SMILES for 3-iodo-N-methylaniline is CNc1cccc(I)c1.
What is the InChIKey of 3-iodo-N-methylaniline?
The InChIKey is KWXWYCMFWSWUQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8IN/c1-9-7-4-2-3-6(8)5-7/h2-5,9H,1H3.
What are the key properties of 3-iodo-N-methylaniline?
3-iodo-N-methylaniline has a molecular weight of 233.05 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-N-methylaniline is sourced from PubChem (CID 11075306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).