About 3-fluoro-N-methylaniline;molecular hydrogen
3-fluoro-N-methylaniline;molecular hydrogen (PubChem CID 143398655) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is 3-fluoro-N-methylaniline;molecular hydrogen.
Molecular Properties
| Compound Name | 3-fluoro-N-methylaniline;molecular hydrogen |
| PubChem CID | 143398655 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 3-fluoro-N-methylaniline;molecular hydrogen |
| SMILES | CNc1cccc(F)c1.[H][H] |
| InChI | InChI=1S/C7H8FN.H2/c1-9-7-4-2-3-6(8)5-7;/h2-5,9H,1H3;1H |
| InChIKey | KLPUARZLNCACIQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-N-methylaniline;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-methylaniline;molecular hydrogen?
The IUPAC name of 3-fluoro-N-methylaniline;molecular hydrogen (CID 143398655) is 3-fluoro-N-methylaniline;molecular hydrogen.
What is the SMILES notation for 3-fluoro-N-methylaniline;molecular hydrogen?
The canonical SMILES for 3-fluoro-N-methylaniline;molecular hydrogen is CNc1cccc(F)c1.[H][H].
What is the InChIKey of 3-fluoro-N-methylaniline;molecular hydrogen?
The InChIKey is KLPUARZLNCACIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN.H2/c1-9-7-4-2-3-6(8)5-7;/h2-5,9H,1H3;1H.
What are the key properties of 3-fluoro-N-methylaniline;molecular hydrogen?
3-fluoro-N-methylaniline;molecular hydrogen has a molecular weight of 127.16 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-methylaniline;molecular hydrogen is sourced from PubChem (CID 143398655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).