C13H13F2N3O — CID 106772538
N-(2,2-difluoroethyl)-1-(methylamino)isoquinoline-4-carboxamide (PubChem CID 106772538) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-(methylamino)isoquinoline-4-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-1-(methylamino)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106772538 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-(methylamino)isoquinoline-4-carboxamide |
| SMILES | CNc1ncc(C(=O)NCC(F)F)c2ccccc12 |
| InChI | InChI=1S/C13H13F2N3O/c1-16-12-9-5-3-2-4-8(9)10(6-17-12)13(19)18-7-11(14)15/h2-6,11H,7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | PTQHQALCCHMKCP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |