C17H23N3O — CID 106770928
N-(2,2-dimethylpropyl)-1-(ethylamino)isoquinoline-4-carboxamide (PubChem CID 106770928) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-1-(ethylamino)isoquinoline-4-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-1-(ethylamino)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106770928 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-(2,2-dimethylpropyl)-1-(ethylamino)isoquinoline-4-carboxamide |
| SMILES | CCNc1ncc(C(=O)NCC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C17H23N3O/c1-5-18-15-13-9-7-6-8-12(13)14(10-19-15)16(21)20-11-17(2,3)4/h6-10H,5,11H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | FCXYQNZQKWYWHT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |