C15H19N3O2 — CID 106770082
1-(ethylamino)-N-(2-methoxyethyl)isoquinoline-4-carboxamide (PubChem CID 106770082) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(ethylamino)-N-(2-methoxyethyl)isoquinoline-4-carboxamide.
| Compound Name | 1-(ethylamino)-N-(2-methoxyethyl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106770082 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(ethylamino)-N-(2-methoxyethyl)isoquinoline-4-carboxamide |
| SMILES | CCNc1ncc(C(=O)NCCOC)c2ccccc12 |
| InChI | InChI=1S/C15H19N3O2/c1-3-16-14-12-7-5-4-6-11(12)13(10-18-14)15(19)17-8-9-20-2/h4-7,10H,3,8-9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | DGNNKNDOAWHUGE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|