C16H21N3O2 — CID 106770431
1-(ethylamino)-N-(3-methoxypropyl)isoquinoline-4-carboxamide (PubChem CID 106770431) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(ethylamino)-N-(3-methoxypropyl)isoquinoline-4-carboxamide.
| Compound Name | 1-(ethylamino)-N-(3-methoxypropyl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106770431 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-(ethylamino)-N-(3-methoxypropyl)isoquinoline-4-carboxamide |
| SMILES | CCNc1ncc(C(=O)NCCCOC)c2ccccc12 |
| InChI | InChI=1S/C16H21N3O2/c1-3-17-15-13-8-5-4-7-12(13)14(11-19-15)16(20)18-9-6-10-21-2/h4-5,7-8,11H,3,6,9-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | BHPQKCUVBNCZRN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|