C17H23N3O — CID 106770044
1-(ethylamino)-N-(2-methylbutan-2-yl)isoquinoline-4-carboxamide (PubChem CID 106770044) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(ethylamino)-N-(2-methylbutan-2-yl)isoquinoline-4-carboxamide.
| Compound Name | 1-(ethylamino)-N-(2-methylbutan-2-yl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106770044 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-(ethylamino)-N-(2-methylbutan-2-yl)isoquinoline-4-carboxamide |
| SMILES | CCNc1ncc(C(=O)NC(C)(C)CC)c2ccccc12 |
| InChI | InChI=1S/C17H23N3O/c1-5-17(3,4)20-16(21)14-11-19-15(18-6-2)13-10-8-7-9-12(13)14/h7-11H,5-6H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | UWHYZUMLVYLHRC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |