C14H13N5OS — CID 106769743
1-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)isoquinoline-4-carboxamide (PubChem CID 106769743) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)isoquinoline-4-carboxamide.
| Compound Name | 1-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106769743 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)isoquinoline-4-carboxamide |
| SMILES | CCNc1ncc(C(=O)Nc2nncs2)c2ccccc12 |
| InChI | InChI=1S/C14H13N5OS/c1-2-15-12-10-6-4-3-5-9(10)11(7-16-12)13(20)18-14-19-17-8-21-14/h3-8H,2H2,1H3,(H,15,16)(H,18,19,20) |
| InChIKey | RNWBYYJRZBBYPB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |