C14H22F3N3O — CID 106773634
6-(2-ethylhexoxy)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106773634) has the molecular formula C14H22F3N3O and a molecular weight of 305.34 g/mol. Its IUPAC name is 6-(2-ethylhexoxy)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(2-ethylhexoxy)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106773634 |
| Molecular Formula | C14H22F3N3O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 6-(2-ethylhexoxy)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCCC(CC)COc1cc(NC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H22F3N3O/c1-4-6-7-10(5-2)9-21-12-8-11(18-3)19-13(20-12)14(15,16)17/h8,10H,4-7,9H2,1-3H3,(H,18,19,20) |
| InChIKey | RWCYPFGEZNPJRY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |