C18H23N3 — CID 106779859
3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 106779859) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106779859 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CC(Cc1ccn(C3CCCC3)n1)CN2 |
| InChI | InChI=1S/C18H23N3/c1-4-8-18-15(5-1)11-14(13-19-18)12-16-9-10-21(20-16)17-6-2-3-7-17/h1,4-5,8-10,14,17,19H,2-3,6-7,11-13H2 |
| InChIKey | ZZRJZICJYVFMPH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |