C12H21N3 — CID 106780433
2-[(1-ethylimidazol-2-yl)methyl]-6-methylpiperidine (PubChem CID 106780433) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-[(1-ethylimidazol-2-yl)methyl]-6-methylpiperidine.
| Compound Name | 2-[(1-ethylimidazol-2-yl)methyl]-6-methylpiperidine |
|---|---|
| PubChem CID | 106780433 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-[(1-ethylimidazol-2-yl)methyl]-6-methylpiperidine |
| SMILES | CCn1ccnc1CC1CCCC(C)N1 |
| InChI | InChI=1S/C12H21N3/c1-3-15-8-7-13-12(15)9-11-6-4-5-10(2)14-11/h7-8,10-11,14H,3-6,9H2,1-2H3 |
| InChIKey | QYAINQHOJYBOKE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |