C12H18F3N3 — CID 106780431
2-[(1-ethylimidazol-2-yl)methyl]-4-(trifluoromethyl)piperidine (PubChem CID 106780431) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-[(1-ethylimidazol-2-yl)methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 2-[(1-ethylimidazol-2-yl)methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 106780431 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[(1-ethylimidazol-2-yl)methyl]-4-(trifluoromethyl)piperidine |
| SMILES | CCn1ccnc1CC1CC(C(F)(F)F)CCN1 |
| InChI | InChI=1S/C12H18F3N3/c1-2-18-6-5-17-11(18)8-10-7-9(3-4-16-10)12(13,14)15/h5-6,9-10,16H,2-4,7-8H2,1H3 |
| InChIKey | RPTJAZWJTMVUEY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |