C15H20F3N — CID 106778077
2-[(3,4-dimethylphenyl)methyl]-4-(trifluoromethyl)piperidine (PubChem CID 106778077) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 2-[(3,4-dimethylphenyl)methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 106778077 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methyl]-4-(trifluoromethyl)piperidine |
| SMILES | Cc1ccc(CC2CC(C(F)(F)F)CCN2)cc1C |
| InChI | InChI=1S/C15H20F3N/c1-10-3-4-12(7-11(10)2)8-14-9-13(5-6-19-14)15(16,17)18/h3-4,7,13-14,19H,5-6,8-9H2,1-2H3 |
| InChIKey | XVLZNVYNAKTXNG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |