C14H15F6N — CID 106778831
4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 106778831) has the molecular formula C14H15F6N and a molecular weight of 311.27 g/mol. Its IUPAC name is 4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 106778831 |
| Molecular Formula | C14H15F6N |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(CC2CC(C(F)(F)F)CCN2)cc1 |
| InChI | InChI=1S/C14H15F6N/c15-13(16,17)10-3-1-9(2-4-10)7-12-8-11(5-6-21-12)14(18,19)20/h1-4,11-12,21H,5-8H2 |
| InChIKey | GXYXPBFAVVREOM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |