C10H10F3NO2S — CID 106782520
oxan-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106782520) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is oxan-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | oxan-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 106782520 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | oxan-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)s1)C1CCCOC1 |
| InChI | InChI=1S/C10H10F3NO2S/c11-10(12,13)9-14-4-7(17-9)8(15)6-2-1-3-16-5-6/h4,6H,1-3,5H2 |
| InChIKey | FKSOVYICHTTWAY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |