C11H12F3NOS — CID 106782437
cyclohexyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106782437) has the molecular formula C11H12F3NOS and a molecular weight of 263.28 g/mol. Its IUPAC name is cyclohexyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | cyclohexyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 106782437 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | cyclohexyl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)s1)C1CCCCC1 |
| InChI | InChI=1S/C11H12F3NOS/c12-11(13,14)10-15-6-8(17-10)9(16)7-4-2-1-3-5-7/h6-7H,1-5H2 |
| InChIKey | KXKSJMGAXKOZJT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |