C11H9F3N2OS — CID 176762819
2-cyclobutyl-2-isocyano-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 176762819) has the molecular formula C11H9F3N2OS and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-cyclobutyl-2-isocyano-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2-cyclobutyl-2-isocyano-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 176762819 |
| Molecular Formula | C11H9F3N2OS |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-cyclobutyl-2-isocyano-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | [C-]#[N+]C(C(=O)c1cnc(C(F)(F)F)s1)C1CCC1 |
| InChI | InChI=1S/C11H9F3N2OS/c1-15-8(6-3-2-4-6)9(17)7-5-16-10(18-7)11(12,13)14/h5-6,8H,2-4H2 |
| InChIKey | JENLBRVUTAMIIK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|