C13H17F3N2S — CID 106783679
2-(cyclohexen-1-yl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 106783679) has the molecular formula C13H17F3N2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 106783679 |
| Molecular Formula | C13H17F3N2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CNC(CC1=CCCCC1)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C13H17F3N2S/c1-17-10(7-9-5-3-2-4-6-9)11-8-18-12(19-11)13(14,15)16/h5,8,10,17H,2-4,6-7H2,1H3 |
| InChIKey | FHMWJMLAYCFEDC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|