C15H21F3N2S — CID 106783681
N-[2-(cyclohexen-1-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]propan-1-amine (PubChem CID 106783681) has the molecular formula C15H21F3N2S and a molecular weight of 318.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106783681 |
| Molecular Formula | C15H21F3N2S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(CC1=CCCCC1)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C15H21F3N2S/c1-2-8-19-12(9-11-6-4-3-5-7-11)13-10-20-14(21-13)15(16,17)18/h6,10,12,19H,2-5,7-9H2,1H3 |
| InChIKey | ATLPUFZLLQGPCN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|