C11H12F3NO4S — CID 106784028
diethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanedioate (PubChem CID 106784028) has the molecular formula C11H12F3NO4S and a molecular weight of 311.28 g/mol. Its IUPAC name is diethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanedioate.
| Compound Name | diethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanedioate |
|---|---|
| PubChem CID | 106784028 |
| Molecular Formula | C11H12F3NO4S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | diethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C11H12F3NO4S/c1-3-18-8(16)7(9(17)19-4-2)6-5-15-10(20-6)11(12,13)14/h5,7H,3-4H2,1-2H3 |
| InChIKey | VZFVRQDPIGJTNY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|