C7H6ClF2NO2S — CID 170912876
ethyl 2-(2-chloro-1,3-thiazol-5-yl)-2,2-difluoroacetate (PubChem CID 170912876) has the molecular formula C7H6ClF2NO2S and a molecular weight of 241.65 g/mol. Its IUPAC name is ethyl 2-(2-chloro-1,3-thiazol-5-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(2-chloro-1,3-thiazol-5-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 170912876 |
| Molecular Formula | C7H6ClF2NO2S |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | ethyl 2-(2-chloro-1,3-thiazol-5-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H6ClF2NO2S/c1-2-13-5(12)7(9,10)4-3-11-6(8)14-4/h3H,2H2,1H3 |
| InChIKey | VSDHHGBFEYJFGN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |