C8H6F3NO3S — CID 155978068
ethyl 2-oxo-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetate (PubChem CID 155978068) has the molecular formula C8H6F3NO3S and a molecular weight of 253.20 g/mol. Its IUPAC name is ethyl 2-oxo-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetate.
| Compound Name | ethyl 2-oxo-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 155978068 |
| Molecular Formula | C8H6F3NO3S |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | ethyl 2-oxo-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetate |
| SMILES | CCOC(=O)C(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H6F3NO3S/c1-2-15-6(14)5(13)4-3-12-7(16-4)8(9,10)11/h3H,2H2,1H3 |
| InChIKey | DHQKPWPKTBYHFF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|