C9H10F3NO2S — CID 106782460
2-propoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 106782460) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is 2-propoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2-propoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 106782460 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-propoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CCCOCC(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H10F3NO2S/c1-2-3-15-5-6(14)7-4-13-8(16-7)9(10,11)12/h4H,2-3,5H2,1H3 |
| InChIKey | WZBNCVFNRCOAPK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|