C9H10F3NO2S — CID 106784035
2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoic acid (PubChem CID 106784035) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoic acid.
| Compound Name | 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 106784035 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H10F3NO2S/c1-2-3-5(7(14)15)6-4-13-8(16-6)9(10,11)12/h4-5H,2-3H2,1H3,(H,14,15) |
| InChIKey | PTSKGKVZHKBZQE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |