C9H9ClF3NS — CID 106784060
5-(2-chlorocyclopentyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 106784060) has the molecular formula C9H9ClF3NS and a molecular weight of 255.69 g/mol. Its IUPAC name is 5-(2-chlorocyclopentyl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-(2-chlorocyclopentyl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 106784060 |
| Molecular Formula | C9H9ClF3NS |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 5-(2-chlorocyclopentyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1ncc(C2CCCC2Cl)s1 |
| InChI | InChI=1S/C9H9ClF3NS/c10-6-3-1-2-5(6)7-4-14-8(15-7)9(11,12)13/h4-6H,1-3H2 |
| InChIKey | OPELBQVHMPFOEV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|