C10H11ClF3NS — CID 106784059
5-(2-chlorocyclohexyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 106784059) has the molecular formula C10H11ClF3NS and a molecular weight of 269.72 g/mol. Its IUPAC name is 5-(2-chlorocyclohexyl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-(2-chlorocyclohexyl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 106784059 |
| Molecular Formula | C10H11ClF3NS |
| Molecular Weight | 269.72 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 5-(2-chlorocyclohexyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1ncc(C2CCCCC2Cl)s1 |
| InChI | InChI=1S/C10H11ClF3NS/c11-7-4-2-1-3-6(7)8-5-15-9(16-8)10(12,13)14/h5-7H,1-4H2 |
| InChIKey | BUVSPJJAZGZOHS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|