C11H15ClF3NS — CID 106784225
5-(3-chloro-4,4-dimethylpentyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 106784225) has the molecular formula C11H15ClF3NS and a molecular weight of 285.76 g/mol. Its IUPAC name is 5-(3-chloro-4,4-dimethylpentyl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-(3-chloro-4,4-dimethylpentyl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 106784225 |
| Molecular Formula | C11H15ClF3NS |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 5-(3-chloro-4,4-dimethylpentyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | CC(C)(C)C(Cl)CCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C11H15ClF3NS/c1-10(2,3)8(12)5-4-7-6-16-9(17-7)11(13,14)15/h6,8H,4-5H2,1-3H3 |
| InChIKey | IPMYADNHHYRAKV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|