C13H19F3N2S — CID 106784482
N-tert-butyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pent-3-en-1-amine (PubChem CID 106784482) has the molecular formula C13H19F3N2S and a molecular weight of 292.37 g/mol. Its IUPAC name is N-tert-butyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pent-3-en-1-amine.
| Compound Name | N-tert-butyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 106784482 |
| Molecular Formula | C13H19F3N2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-tert-butyl-4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pent-3-en-1-amine |
| SMILES | CC(=CCCNC(C)(C)C)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C13H19F3N2S/c1-9(6-5-7-18-12(2,3)4)10-8-17-11(19-10)13(14,15)16/h6,8,18H,5,7H2,1-4H3 |
| InChIKey | SVMHOBHBSJQBJJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|