C11H8F3NO2S — CID 106784585
2-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]phenol (PubChem CID 106784585) has the molecular formula C11H8F3NO2S and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]phenol.
| Compound Name | 2-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]phenol |
|---|---|
| PubChem CID | 106784585 |
| Molecular Formula | C11H8F3NO2S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-methoxy-6-[2-(trifluoromethyl)-1,3-thiazol-5-yl]phenol |
| SMILES | COc1cccc(-c2cnc(C(F)(F)F)s2)c1O |
| InChI | InChI=1S/C11H8F3NO2S/c1-17-7-4-2-3-6(9(7)16)8-5-15-10(18-8)11(12,13)14/h2-5,16H,1H3 |
| InChIKey | YLKOICMSKBQSPF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |