C9H6F3N3S — CID 106783896
3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pyridin-2-amine (PubChem CID 106783896) has the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 106783896 |
| Molecular Formula | C9H6F3N3S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H6F3N3S/c10-9(11,12)8-15-4-6(16-8)5-2-1-3-14-7(5)13/h1-4H,(H2,13,14) |
| InChIKey | XRFBDIJVLWKVRG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |