C9H4BrF3N2S — CID 106784270
5-(6-bromo-2-pyridinyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 106784270) has the molecular formula C9H4BrF3N2S and a molecular weight of 309.11 g/mol. Its IUPAC name is 5-(6-bromo-2-pyridinyl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-(6-bromo-2-pyridinyl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 106784270 |
| Molecular Formula | C9H4BrF3N2S |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | 5-(6-bromo-2-pyridinyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1ncc(-c2cccc(Br)n2)s1 |
| InChI | InChI=1S/C9H4BrF3N2S/c10-7-3-1-2-5(15-7)6-4-14-8(16-6)9(11,12)13/h1-4H |
| InChIKey | UKYJTLDOSASHBZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|