C11H5BrF3NO2S — CID 114026517
2-bromo-5-[2-(trifluoromethyl)-1,3-thiazol-5-yl]benzoic acid (PubChem CID 114026517) has the molecular formula C11H5BrF3NO2S and a molecular weight of 352.13 g/mol. Its IUPAC name is 2-bromo-5-[2-(trifluoromethyl)-1,3-thiazol-5-yl]benzoic acid.
| Compound Name | 2-bromo-5-[2-(trifluoromethyl)-1,3-thiazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 114026517 |
| Molecular Formula | C11H5BrF3NO2S |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 350.92 |
| IUPAC Name | 2-bromo-5-[2-(trifluoromethyl)-1,3-thiazol-5-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2cnc(C(F)(F)F)s2)ccc1Br |
| InChI | InChI=1S/C11H5BrF3NO2S/c12-7-2-1-5(3-6(7)9(17)18)8-4-16-10(19-8)11(13,14)15/h1-4H,(H,17,18) |
| InChIKey | JISJXEQWVBFXAV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |